C11H19NO2S — CID 123194677
N-cyclohexylpenta-2,4-diene-2-sulfonamide (PubChem CID 123194677) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is N-cyclohexylpenta-2,4-diene-2-sulfonamide.
| Compound Name | N-cyclohexylpenta-2,4-diene-2-sulfonamide |
|---|---|
| PubChem CID | 123194677 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-cyclohexylpenta-2,4-diene-2-sulfonamide |
| SMILES | C=CC=C(C)S(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H19NO2S/c1-3-7-10(2)15(13,14)12-11-8-5-4-6-9-11/h3,7,11-12H,1,4-6,8-9H2,2H3 |
| InChIKey | VXEPWPNNNFMGGH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|