C25H32N2O3 — CID 163593216
(4R)-3-[(1-acetylpiperidin-4-yl)methyl]-4-amino-5-(4-phenylphenyl)pentanoic acid (PubChem CID 163593216) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (4R)-3-[(1-acetylpiperidin-4-yl)methyl]-4-amino-5-(4-phenylphenyl)pentanoic acid.
| Compound Name | (4R)-3-[(1-acetylpiperidin-4-yl)methyl]-4-amino-5-(4-phenylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 163593216 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (4R)-3-[(1-acetylpiperidin-4-yl)methyl]-4-amino-5-(4-phenylphenyl)pentanoic acid |
| SMILES | CC(=O)N1CCC(CC(CC(=O)O)[C@H](N)Cc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H32N2O3/c1-18(28)27-13-11-20(12-14-27)15-23(17-25(29)30)24(26)16-19-7-9-22(10-8-19)21-5-3-2-4-6-21/h2-10,20,23-24H,11-17,26H2,1H3,(H,29,30)/t23?,24-/m1/s1 |
| InChIKey | GRGJJRNXDVTFCN-XMMISQBUSA-N |
| XLogP | 3.96 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |