C22H40N2O — CID 90770756
ethane;1-[4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidin-1-yl]ethanone (PubChem CID 90770756) has the molecular formula C22H40N2O and a molecular weight of 348.58 g/mol. Its IUPAC name is ethane;1-[4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidin-1-yl]ethanone.
| Compound Name | ethane;1-[4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90770756 |
| Molecular Formula | C22H40N2O |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.31 |
| IUPAC Name | ethane;1-[4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidin-1-yl]ethanone |
| SMILES | CC.CC.CC(=O)N1CCC(CN(C)C(C)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N2O.2C2H6/c1-15(13-17-7-5-4-6-8-17)19(3)14-18-9-11-20(12-10-18)16(2)21;2*1-2/h4-8,15,18H,9-14H2,1-3H3;2*1-2H3 |
| InChIKey | GYDDZBWXZGWQHP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |