C21H39N3O2S — CID 90743566
ethane;N-methyl-N-[(1-methylpiperidin-4-yl)methyl]-1-phenylpropan-2-amine;N-methyl-1-sulfonylmethanamine (PubChem CID 90743566) has the molecular formula C21H39N3O2S and a molecular weight of 397.63 g/mol. Its IUPAC name is ethane;N-methyl-N-[(1-methylpiperidin-4-yl)methyl]-1-phenylpropan-2-amine;N-methyl-1-sulfonylmethanamine.
| Compound Name | ethane;N-methyl-N-[(1-methylpiperidin-4-yl)methyl]-1-phenylpropan-2-amine;N-methyl-1-sulfonylmethanamine |
|---|---|
| PubChem CID | 90743566 |
| Molecular Formula | C21H39N3O2S |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | ethane;N-methyl-N-[(1-methylpiperidin-4-yl)methyl]-1-phenylpropan-2-amine;N-methyl-1-sulfonylmethanamine |
| SMILES | CC.CC(Cc1ccccc1)N(C)CC1CCN(C)CC1.CNC=S(=O)=O |
| InChI | InChI=1S/C17H28N2.C2H5NO2S.C2H6/c1-15(13-16-7-5-4-6-8-16)19(3)14-17-9-11-18(2)12-10-17;1-3-2-6(4)5;1-2/h4-8,15,17H,9-14H2,1-3H3;2-3H,1H3;1-2H3 |
| InChIKey | LRLXKSUXCJWMHD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|