C16H25ClN2O2S — CID 20706309
chloro 4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidine-1-sulfinate (PubChem CID 20706309) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is chloro 4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidine-1-sulfinate.
| Compound Name | chloro 4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidine-1-sulfinate |
|---|---|
| PubChem CID | 20706309 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | chloro 4-[[methyl(1-phenylpropan-2-yl)amino]methyl]piperidine-1-sulfinate |
| SMILES | CC(Cc1ccccc1)N(C)CC1CCN(S(=O)OCl)CC1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-14(12-15-6-4-3-5-7-15)18(2)13-16-8-10-19(11-9-16)22(20)21-17/h3-7,14,16H,8-13H2,1-2H3 |
| InChIKey | XFWCZIYQBFTJQJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |