C16H21IN3O5- — CID 163594397
[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[(2-ethoxy-2-oxoethyl)amino]-5-methoxyphenyl]-oxidoazanium iodide (PubChem CID 163594397) has the molecular formula C16H21IN3O5- and a molecular weight of 462.26 g/mol. Its IUPAC name is [4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[(2-ethoxy-2-oxoethyl)amino]-5-methoxyphenyl]-oxidoazanium iodide.
| Compound Name | [4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[(2-ethoxy-2-oxoethyl)amino]-5-methoxyphenyl]-oxidoazanium iodide |
|---|---|
| PubChem CID | 163594397 |
| Molecular Formula | C16H21IN3O5- |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | [4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[(2-ethoxy-2-oxoethyl)amino]-5-methoxyphenyl]-oxidoazanium iodide |
| SMILES | CCOC(=O)CNc1cc(-c2c(C)noc2C)c(OC)cc1[NH2+][O-].[I-] |
| InChI | InChI=1S/C16H21N3O5.HI/c1-5-23-15(20)8-17-12-6-11(14(22-4)7-13(12)18-21)16-9(2)19-24-10(16)3;/h6-7,17H,5,8,18H2,1-4H3;1H/p-1 |
| InChIKey | APXYKWHVGQPLSB-UHFFFAOYSA-M |
| XLogP | -1.36 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|