C13H20 — CID 163594846
(1S)-1-methyl-7-[(E)-prop-1-enyl]tricyclo[4.2.1.02,4]nonane (PubChem CID 163594846) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (1S)-1-methyl-7-[(E)-prop-1-enyl]tricyclo[4.2.1.02,4]nonane.
| Compound Name | (1S)-1-methyl-7-[(E)-prop-1-enyl]tricyclo[4.2.1.02,4]nonane |
|---|---|
| PubChem CID | 163594846 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (1S)-1-methyl-7-[(E)-prop-1-enyl]tricyclo[4.2.1.02,4]nonane |
| SMILES | C/C=C/C1C[C@]2(C)CC1CC1CC12 |
| InChI | InChI=1S/C13H20/c1-3-4-9-7-13(2)8-11(9)5-10-6-12(10)13/h3-4,9-12H,5-8H2,1-2H3/b4-3+/t9?,10?,11?,12?,13-/m1/s1 |
| InChIKey | GSOLRJUWRRRFGM-IZLXBKJDSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|