C34H58 — CID 157196446
3,5,5,6,6-pentamethyl-1-[(E)-prop-1-enyl]-1,2,3,3a,4,6a-hexahydropentalene;3,8,8,9,9-pentamethyl-5-[(E)-prop-1-enyl]tricyclo[5.2.1.02,6]decane (PubChem CID 157196446) has the molecular formula C34H58 and a molecular weight of 466.84 g/mol. Its IUPAC name is 3,5,5,6,6-pentamethyl-1-[(E)-prop-1-enyl]-1,2,3,3a,4,6a-hexahydropentalene;3,8,8,9,9-pentamethyl-5-[(E)-prop-1-enyl]tricyclo[5.2.1.02,6]decane.
| Compound Name | 3,5,5,6,6-pentamethyl-1-[(E)-prop-1-enyl]-1,2,3,3a,4,6a-hexahydropentalene;3,8,8,9,9-pentamethyl-5-[(E)-prop-1-enyl]tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 157196446 |
| Molecular Formula | C34H58 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.45 |
| IUPAC Name | 3,5,5,6,6-pentamethyl-1-[(E)-prop-1-enyl]-1,2,3,3a,4,6a-hexahydropentalene;3,8,8,9,9-pentamethyl-5-[(E)-prop-1-enyl]tricyclo[5.2.1.02,6]decane |
| SMILES | C/C=C/C1CC(C)C2C1C1CC2C(C)(C)C1(C)C.C/C=C/C1CC(C)C2CC(C)(C)C(C)(C)C12 |
| InChI | InChI=1S/C18H30.C16H28/c1-7-8-12-9-11(2)15-13-10-14(16(12)15)18(5,6)17(13,3)4;1-7-8-12-9-11(2)13-10-15(3,4)16(5,6)14(12)13/h7-8,11-16H,9-10H2,1-6H3;7-8,11-14H,9-10H2,1-6H3/b2*8-7+ |
| InChIKey | AQHOCMYHRPYKDR-ONYUMSKCSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|