C13H25N — CID 163596317
5,5,7-trimethyl-2,4-dimethylideneoctan-1-amine (PubChem CID 163596317) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 5,5,7-trimethyl-2,4-dimethylideneoctan-1-amine.
| Compound Name | 5,5,7-trimethyl-2,4-dimethylideneoctan-1-amine |
|---|---|
| PubChem CID | 163596317 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 5,5,7-trimethyl-2,4-dimethylideneoctan-1-amine |
| SMILES | C=C(CN)CC(=C)C(C)(C)CC(C)C |
| InChI | InChI=1S/C13H25N/c1-10(2)8-13(5,6)12(4)7-11(3)9-14/h10H,3-4,7-9,14H2,1-2,5-6H3 |
| InChIKey | GTTBEJMTSWVTKZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|