C31H30F3N3O6 — CID 163599052
(1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(3-phenylphenyl)methoxy]butan-2-one (PubChem CID 163599052) has the molecular formula C31H30F3N3O6 and a molecular weight of 597.59 g/mol. Its IUPAC name is (1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(3-phenylphenyl)methoxy]butan-2-one.
| Compound Name | (1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(3-phenylphenyl)methoxy]butan-2-one |
|---|---|
| PubChem CID | 163599052 |
| Molecular Formula | C31H30F3N3O6 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | (1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(3-phenylphenyl)methoxy]butan-2-one |
| SMILES | CCC(=O)[C@@H](OCc1cccc(-c2ccccc2)c1)[C@@H]1OC(CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C31H30F3N3O6/c1-2-24(39)30(42-16-17-7-6-10-19(11-17)18-8-4-3-5-9-18)31-29(41)27(28(40)25(15-38)43-31)37-14-23(35-36-37)20-12-21(32)26(34)22(33)13-20/h3-14,25,27-31,38,40-41H,2,15-16H2,1H3/t25?,27-,28-,29?,30+,31+/m0/s1 |
| InChIKey | GWAJMDOPRRUBIB-DTZBCMJLSA-N |
| XLogP | 3.62 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|