C25H25F4N3O6 — CID 163682172
(1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(4-fluorophenyl)methoxy]butan-2-one (PubChem CID 163682172) has the molecular formula C25H25F4N3O6 and a molecular weight of 539.48 g/mol. Its IUPAC name is (1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(4-fluorophenyl)methoxy]butan-2-one.
| Compound Name | (1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(4-fluorophenyl)methoxy]butan-2-one |
|---|---|
| PubChem CID | 163682172 |
| Molecular Formula | C25H25F4N3O6 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (1S)-1-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-1-[(4-fluorophenyl)methoxy]butan-2-one |
| SMILES | CCC(=O)[C@@H](OCc1ccc(F)cc1)[C@@H]1OC(CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C25H25F4N3O6/c1-2-18(34)24(37-11-12-3-5-14(26)6-4-12)25-23(36)21(22(35)19(10-33)38-25)32-9-17(30-31-32)13-7-15(27)20(29)16(28)8-13/h3-9,19,21-25,33,35-36H,2,10-11H2,1H3/t19?,21-,22-,23?,24+,25+/m0/s1 |
| InChIKey | JLSXZFPLERFYFB-KHAPHURPSA-N |
| XLogP | 2.09 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|