C26H28ClF3N4O5 — CID 163435218
(2S)-2-[(4-chlorophenyl)methoxy]-2-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-N,N-dimethylacetamide (PubChem CID 163435218) has the molecular formula C26H28ClF3N4O5 and a molecular weight of 568.98 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methoxy]-2-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-N,N-dimethylacetamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)methoxy]-2-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 163435218 |
| Molecular Formula | C26H28ClF3N4O5 |
| Molecular Weight | 568.98 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methoxy]-2-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]-N,N-dimethylacetamide |
| SMILES | CC1[C@H]([C@H](OCc2ccc(Cl)cc2)C(=O)N(C)C)OC(CO)[C@H](O)[C@@H]1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C26H28ClF3N4O5/c1-13-22(34-10-19(31-32-34)15-8-17(28)21(30)18(29)9-15)23(36)20(11-35)39-24(13)25(26(37)33(2)3)38-12-14-4-6-16(27)7-5-14/h4-10,13,20,22-25,35-36H,11-12H2,1-3H3/t13?,20?,22-,23+,24-,25+/m1/s1 |
| InChIKey | ATXNXCJBERIGBT-MLYXYHGYSA-N |
| XLogP | 2.99 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.98 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|