C27H26ClF6N3O5 — CID 163817538
(1S)-1-[(4-chlorophenyl)methoxy]-5,5,5-trifluoro-1-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]pentan-2-one (PubChem CID 163817538) has the molecular formula C27H26ClF6N3O5 and a molecular weight of 621.96 g/mol. Its IUPAC name is (1S)-1-[(4-chlorophenyl)methoxy]-5,5,5-trifluoro-1-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]pentan-2-one.
| Compound Name | (1S)-1-[(4-chlorophenyl)methoxy]-5,5,5-trifluoro-1-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 163817538 |
| Molecular Formula | C27H26ClF6N3O5 |
| Molecular Weight | 621.96 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | (1S)-1-[(4-chlorophenyl)methoxy]-5,5,5-trifluoro-1-[(2R,4R,5R)-5-hydroxy-6-(hydroxymethyl)-3-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]pentan-2-one |
| SMILES | CC1[C@H]([C@H](OCc2ccc(Cl)cc2)C(=O)CCC(F)(F)F)OC(CO)[C@H](O)[C@@H]1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C27H26ClF6N3O5/c1-13-23(37-10-19(35-36-37)15-8-17(29)22(31)18(30)9-15)24(40)21(11-38)42-25(13)26(20(39)6-7-27(32,33)34)41-12-14-2-4-16(28)5-3-14/h2-5,8-10,13,21,23-26,38,40H,6-7,11-12H2,1H3/t13?,21?,23-,24+,25-,26-/m1/s1 |
| InChIKey | NSPPPCHWLVSHQQ-ZJIHVKCKSA-N |
| XLogP | 4.81 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.96 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|