C13H22BrClN4O2 — CID 163602159
tert-butyl N-[3-[(5-bromo-2-chloro-1,4-dihydropyrimidin-4-yl)amino]propyl]-N-methylcarbamate (PubChem CID 163602159) has the molecular formula C13H22BrClN4O2 and a molecular weight of 381.70 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-bromo-2-chloro-1,4-dihydropyrimidin-4-yl)amino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[(5-bromo-2-chloro-1,4-dihydropyrimidin-4-yl)amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163602159 |
| Molecular Formula | C13H22BrClN4O2 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | tert-butyl N-[3-[(5-bromo-2-chloro-1,4-dihydropyrimidin-4-yl)amino]propyl]-N-methylcarbamate |
| SMILES | CN(CCCNC1N=C(Cl)NC=C1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22BrClN4O2/c1-13(2,3)21-12(20)19(4)7-5-6-16-10-9(14)8-17-11(15)18-10/h8,10,16H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | GYOWYIUWKRQXJT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|