C17H24ClN3O4 — CID 59564320
tert-butyl N-[3-[(6-chloro-4-oxo-2,3-dihydro-1,3-benzoxazin-7-yl)amino]propyl]-N-methylcarbamate (PubChem CID 59564320) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-chloro-4-oxo-2,3-dihydro-1,3-benzoxazin-7-yl)amino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[(6-chloro-4-oxo-2,3-dihydro-1,3-benzoxazin-7-yl)amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59564320 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | tert-butyl N-[3-[(6-chloro-4-oxo-2,3-dihydro-1,3-benzoxazin-7-yl)amino]propyl]-N-methylcarbamate |
| SMILES | CN(CCCNc1cc2c(cc1Cl)C(=O)NCO2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24ClN3O4/c1-17(2,3)25-16(23)21(4)7-5-6-19-13-9-14-11(8-12(13)18)15(22)20-10-24-14/h8-9,19H,5-7,10H2,1-4H3,(H,20,22) |
| InChIKey | NTKPVOSTCARVQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|