C20H17N3O2 — CID 163602287
5-[2-[2-(3-hydroxyphenyl)ethyl]pyrimidin-5-yl]-1,3-dihydroindol-2-one (PubChem CID 163602287) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-[2-[2-(3-hydroxyphenyl)ethyl]pyrimidin-5-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[2-(3-hydroxyphenyl)ethyl]pyrimidin-5-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 163602287 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 5-[2-[2-(3-hydroxyphenyl)ethyl]pyrimidin-5-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3cnc(CCc4cccc(O)c4)nc3)ccc2N1 |
| InChI | InChI=1S/C20H17N3O2/c24-17-3-1-2-13(8-17)4-7-19-21-11-16(12-22-19)14-5-6-18-15(9-14)10-20(25)23-18/h1-3,5-6,8-9,11-12,24H,4,7,10H2,(H,23,25) |
| InChIKey | GYRLQESRVRHTIE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |