C14H12 — CID 163604977
2-(2-methylphenyl)cyclohepta-1,3-dien-5-yne (PubChem CID 163604977) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(2-methylphenyl)cyclohepta-1,3-dien-5-yne.
| Compound Name | 2-(2-methylphenyl)cyclohepta-1,3-dien-5-yne |
|---|---|
| PubChem CID | 163604977 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(2-methylphenyl)cyclohepta-1,3-dien-5-yne |
| SMILES | Cc1ccccc1C1=CCC#CC=C1 |
| InChI | InChI=1S/C14H12/c1-12-8-6-7-11-14(12)13-9-4-2-3-5-10-13/h4,6-11H,5H2,1H3 |
| InChIKey | HAYSJGTWVDXSFJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|