About 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene
1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene (PubChem CID 123864976) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene.
Analyze 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene?
The IUPAC name of 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene (CID 123864976) is 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene.
What is the SMILES notation for 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene?
The canonical SMILES for 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene is CC1=CCCC=C1c1ccccc1C.
What is the InChIKey of 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene?
The InChIKey is NVEMAYNONKQZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-11-7-3-5-9-13(11)14-10-6-4-8-12(14)2/h3,5,7-10H,4,6H2,1-2H3.
What are the key properties of 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene?
1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene has a molecular weight of 184.28 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(6-methylcyclohexa-1,5-dien-1-yl)benzene is sourced from PubChem (CID 123864976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).