C16H16O2 — CID 143477541
2,3-dihydrophenanthrene-9,10-dione;ethane (PubChem CID 143477541) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2,3-dihydrophenanthrene-9,10-dione;ethane.
| Compound Name | 2,3-dihydrophenanthrene-9,10-dione;ethane |
|---|---|
| PubChem CID | 143477541 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2,3-dihydrophenanthrene-9,10-dione;ethane |
| SMILES | CC.O=C1C(=O)c2ccccc2C2=CCCC=C12 |
| InChI | InChI=1S/C14H10O2.C2H6/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16;1-2/h1,3,5-8H,2,4H2;1-2H3 |
| InChIKey | JAZWFOPZRTURHW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|