C15H18 — CID 142275666
3,9-dihydro-2H-fluorene;ethane (PubChem CID 142275666) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3,9-dihydro-2H-fluorene;ethane.
| Compound Name | 3,9-dihydro-2H-fluorene;ethane |
|---|---|
| PubChem CID | 142275666 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3,9-dihydro-2H-fluorene;ethane |
| SMILES | C1=C2Cc3ccccc3C2=CCC1.CC |
| InChI | InChI=1S/C13H12.C2H6/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h1,3,5-8H,2,4,9H2;1-2H3 |
| InChIKey | QAAYAHZKHUSBFE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |