C13H12FP — CID 134228919
2-fluoro-4,10-dihydro-3H-indeno[2,1-c]phosphepine (PubChem CID 134228919) has the molecular formula C13H12FP and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-fluoro-4,10-dihydro-3H-indeno[2,1-c]phosphepine.
| Compound Name | 2-fluoro-4,10-dihydro-3H-indeno[2,1-c]phosphepine |
|---|---|
| PubChem CID | 134228919 |
| Molecular Formula | C13H12FP |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-fluoro-4,10-dihydro-3H-indeno[2,1-c]phosphepine |
| SMILES | FP1C=C2Cc3ccccc3C2=CCC1 |
| InChI | InChI=1S/C13H12FP/c14-15-7-3-6-13-11(9-15)8-10-4-1-2-5-12(10)13/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | OLEICWDNYONLRG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|