C31H42N2O3 — CID 163607072
(10S,13R)-17-(cyclopropylmethyl)-13-ethyl-12-(hydroxymethylamino)-4-methoxy-10-methyl-13-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol (PubChem CID 163607072) has the molecular formula C31H42N2O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is (10S,13R)-17-(cyclopropylmethyl)-13-ethyl-12-(hydroxymethylamino)-4-methoxy-10-methyl-13-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol.
| Compound Name | (10S,13R)-17-(cyclopropylmethyl)-13-ethyl-12-(hydroxymethylamino)-4-methoxy-10-methyl-13-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol |
|---|---|
| PubChem CID | 163607072 |
| Molecular Formula | C31H42N2O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (10S,13R)-17-(cyclopropylmethyl)-13-ethyl-12-(hydroxymethylamino)-4-methoxy-10-methyl-13-phenyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-ol |
| SMILES | CC[C@]1(c2ccccc2)CC23CCN(CC4CC4)C(Cc4ccc(OC)c(O)c42)[C@@]3(C)CC1NCO |
| InChI | InChI=1S/C31H42N2O3/c1-4-30(23-8-6-5-7-9-23)19-31-14-15-33(18-21-10-11-21)26(29(31,2)17-25(30)32-20-34)16-22-12-13-24(36-3)28(35)27(22)31/h5-9,12-13,21,25-26,32,34-35H,4,10-11,14-20H2,1-3H3/t25?,26?,29-,30-,31?/m1/s1 |
| InChIKey | HCRVXLLJDQHXER-WMVAHYRFSA-N |
| XLogP | 4.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|