C30H36N2O4 — CID 71509574
(3S)-5-benzyl-20-(cyclopropylmethyl)-15-methoxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-6,16-diol (PubChem CID 71509574) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is (3S)-5-benzyl-20-(cyclopropylmethyl)-15-methoxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-6,16-diol.
| Compound Name | (3S)-5-benzyl-20-(cyclopropylmethyl)-15-methoxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-6,16-diol |
|---|---|
| PubChem CID | 71509574 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (3S)-5-benzyl-20-(cyclopropylmethyl)-15-methoxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-6,16-diol |
| SMILES | COc1ccc2c(c1O)C13CCN(CC4CC4)C(C2)C12CCC1(O)C3C(CN1Cc1ccccc1)O2 |
| InChI | InChI=1S/C30H36N2O4/c1-35-22-10-9-21-15-24-29-11-12-30(34)27(23(36-29)18-32(30)17-19-5-3-2-4-6-19)28(29,25(21)26(22)33)13-14-31(24)16-20-7-8-20/h2-6,9-10,20,23-24,27,33-34H,7-8,11-18H2,1H3 |
| InChIKey | BUDVYMUGSUFKBO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |