C35H38N2O2 — CID 90384541
(1R,2S,3S,6R,9S,10R)-5-benzhydryl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 90384541) has the molecular formula C35H38N2O2 and a molecular weight of 518.70 g/mol. Its IUPAC name is (1R,2S,3S,6R,9S,10R)-5-benzhydryl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (1R,2S,3S,6R,9S,10R)-5-benzhydryl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 90384541 |
| Molecular Formula | C35H38N2O2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (1R,2S,3S,6R,9S,10R)-5-benzhydryl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | Oc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)[C@]12CC[C@@H]1[C@H]3[C@@H](CN1C(c1ccccc1)c1ccccc1)O2 |
| InChI | InChI=1S/C35H38N2O2/c38-27-14-13-26-19-31-35-16-15-29-32(34(35,28(26)20-27)17-18-36(31)21-23-11-12-23)30(39-35)22-37(29)33(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-10,13-14,20,23,29-33,38H,11-12,15-19,21-22H2/t29-,30-,31-,32+,34+,35-/m1/s1 |
| InChIKey | YMDFPWVRQKWFKV-OMAOPYAOSA-N |
| XLogP | 5.69 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |