C30H31N3O2 — CID 90384416
(1R,3S,9S,10R)-5-benzoyl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-15-carbonitrile (PubChem CID 90384416) has the molecular formula C30H31N3O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is (1R,3S,9S,10R)-5-benzoyl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-15-carbonitrile.
| Compound Name | (1R,3S,9S,10R)-5-benzoyl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-15-carbonitrile |
|---|---|
| PubChem CID | 90384416 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (1R,3S,9S,10R)-5-benzoyl-20-(cyclopropylmethyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-15-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H](C2)[C@]12CCC1C3[C@@H](CN1C(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C30H31N3O2/c31-16-20-8-9-22-15-26-30-11-10-24-27(25(35-30)18-33(24)28(34)21-4-2-1-3-5-21)29(30,23(22)14-20)12-13-32(26)17-19-6-7-19/h1-5,8-9,14,19,24-27H,6-7,10-13,15,17-18H2/t24?,25-,26-,27?,29+,30-/m1/s1 |
| InChIKey | MDVSXYVEZJFEDZ-WHEXGJMSSA-N |
| XLogP | 3.91 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |