C30H31N3O3 — CID 90384921
3-[(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]benzonitrile (PubChem CID 90384921) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 3-[(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]benzonitrile.
| Compound Name | 3-[(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 90384921 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 3-[(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2C[C@H]3O[C@@]45CC[C@@H]2[C@@H]3[C@@]42CCN(CC3CC3)[C@@H]5Cc3ccc(O)cc32)c1 |
| InChI | InChI=1S/C30H31N3O3/c31-15-19-2-1-3-21(12-19)28(35)33-17-25-27-24(33)8-9-30(36-25)26-13-20-6-7-22(34)14-23(20)29(27,30)10-11-32(26)16-18-4-5-18/h1-3,6-7,12,14,18,24-27,34H,4-5,8-11,13,16-17H2/t24-,25-,26-,27+,29+,30-/m1/s1 |
| InChIKey | KHVMMBCBTNSHJW-PWKSFPCTSA-N |
| XLogP | 3.61 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |