C35H36N2O3 — CID 126694692
[(3S)-15-hydroxy-4-methylidene-20-(3-phenylpropyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone (PubChem CID 126694692) has the molecular formula C35H36N2O3 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(3S)-15-hydroxy-4-methylidene-20-(3-phenylpropyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone.
| Compound Name | [(3S)-15-hydroxy-4-methylidene-20-(3-phenylpropyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 126694692 |
| Molecular Formula | C35H36N2O3 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(3S)-15-hydroxy-4-methylidene-20-(3-phenylpropyl)-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
| SMILES | C=C1[C@H]2OC34CCC(C2C32CCN(CCCc3ccccc3)C4Cc3ccc(O)cc32)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H36N2O3/c1-23-32-31-29(37(23)33(39)25-12-6-3-7-13-25)16-17-35(40-32)30-21-26-14-15-27(38)22-28(26)34(31,35)18-20-36(30)19-8-11-24-9-4-2-5-10-24/h2-7,9-10,12-15,22,29-32,38H,1,8,11,16-21H2/t29?,30?,31?,32-,34?,35?/m1/s1 |
| InChIKey | QHGPZXUYOMOCPE-NVXGEVLFSA-N |
| XLogP | 5.48 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |