C34H41N3O4 — CID 71510167
3-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-N,N-diethylbenzamide (PubChem CID 71510167) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is 3-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-N,N-diethylbenzamide.
| Compound Name | 3-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 71510167 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 3-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(C(=O)N2C[C@H]3OC45CCC2C3C42CCN(CC3CC3)C5Cc3ccc(O)cc32)c1 |
| InChI | InChI=1S/C34H41N3O4/c1-3-35(4-2)31(39)23-6-5-7-24(16-23)32(40)37-20-28-30-27(37)12-13-34(41-28)29-17-22-10-11-25(38)18-26(22)33(30,34)14-15-36(29)19-21-8-9-21/h5-7,10-11,16,18,21,27-30,38H,3-4,8-9,12-15,17,19-20H2,1-2H3/t27?,28-,29?,30?,33?,34?/m1/s1 |
| InChIKey | OPRFPIKIMBJKBN-HMZCHHTBSA-N |
| XLogP | 4.22 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |