C36H38N2O2 — CID 90392354
(3S)-20-(cyclopropylmethyl)-5-[1-(3-phenylphenyl)ethenyl]-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 90392354) has the molecular formula C36H38N2O2 and a molecular weight of 530.71 g/mol. Its IUPAC name is (3S)-20-(cyclopropylmethyl)-5-[1-(3-phenylphenyl)ethenyl]-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (3S)-20-(cyclopropylmethyl)-5-[1-(3-phenylphenyl)ethenyl]-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 90392354 |
| Molecular Formula | C36H38N2O2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (3S)-20-(cyclopropylmethyl)-5-[1-(3-phenylphenyl)ethenyl]-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | C=C(c1cccc(-c2ccccc2)c1)N1C[C@H]2OC34CCC1C2C31CCN(CC2CC2)C4Cc2ccc(O)cc21 |
| InChI | InChI=1S/C36H38N2O2/c1-23(26-8-5-9-27(18-26)25-6-3-2-4-7-25)38-22-32-34-31(38)14-15-36(40-32)33-19-28-12-13-29(39)20-30(28)35(34,36)16-17-37(33)21-24-10-11-24/h2-9,12-13,18,20,24,31-34,39H,1,10-11,14-17,19,21-22H2/t31?,32-,33?,34?,35?,36?/m1/s1 |
| InChIKey | KTLUSESDCCNTRW-VXYDPBJZSA-N |
| XLogP | 6.24 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |