C29H35FN2O3 — CID 159084606
[(3S)-20-[(2S)-2-fluoropropyl]-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone;methane (PubChem CID 159084606) has the molecular formula C29H35FN2O3 and a molecular weight of 478.61 g/mol. Its IUPAC name is [(3S)-20-[(2S)-2-fluoropropyl]-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone;methane.
| Compound Name | [(3S)-20-[(2S)-2-fluoropropyl]-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone;methane |
|---|---|
| PubChem CID | 159084606 |
| Molecular Formula | C29H35FN2O3 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [(3S)-20-[(2S)-2-fluoropropyl]-15-hydroxy-21-oxa-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone;methane |
| SMILES | C.C[C@H](F)CN1CCC23c4cc(O)ccc4CC1C21CCC2C3[C@@H](CN2C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C28H31FN2O3.CH4/c1-17(29)15-30-12-11-27-21-14-20(32)8-7-19(21)13-24(30)28(27)10-9-22-25(27)23(34-28)16-31(22)26(33)18-5-3-2-4-6-18;/h2-8,14,17,22-25,32H,9-13,15-16H2,1H3;1H4/t17-,22?,23+,24?,25?,27?,28?;/m0./s1 |
| InChIKey | KBHDXLSQFWGIMB-DZZYQUAZSA-N |
| XLogP | 4.33 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |