C29H48 — CID 163608486
(2'R,11'R,16'R)-2',16'-dimethyl-15'-(5-methylhexyl)spiro[cyclopropane-1,5'-tetracyclo[9.7.0.02,7.012,16]octadec-7-ene] (PubChem CID 163608486) has the molecular formula C29H48 and a molecular weight of 396.70 g/mol. Its IUPAC name is (2'R,11'R,16'R)-2',16'-dimethyl-15'-(5-methylhexyl)spiro[cyclopropane-1,5'-tetracyclo[9.7.0.02,7.012,16]octadec-7-ene].
| Compound Name | (2'R,11'R,16'R)-2',16'-dimethyl-15'-(5-methylhexyl)spiro[cyclopropane-1,5'-tetracyclo[9.7.0.02,7.012,16]octadec-7-ene] |
|---|---|
| PubChem CID | 163608486 |
| Molecular Formula | C29H48 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | (2'R,11'R,16'R)-2',16'-dimethyl-15'-(5-methylhexyl)spiro[cyclopropane-1,5'-tetracyclo[9.7.0.02,7.012,16]octadec-7-ene] |
| SMILES | CC(C)CCCCC1CCC2[C@H]3CCC=C4CC5(CC5)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C29H48/c1-21(2)8-5-6-9-22-12-13-25-24-11-7-10-23-20-29(18-19-29)17-16-28(23,4)26(24)14-15-27(22,25)3/h10,21-22,24-26H,5-9,11-20H2,1-4H3/t22?,24-,25?,26?,27-,28+/m1/s1 |
| InChIKey | HDWJUVBHGVLVCQ-AWZLGKKISA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|