C10H10ClF3N3+ — CID 163612261
(3-chloro-1,1,1-trifluoro-4-imino-4-pyridin-3-ylbut-2-en-2-yl)-methylazanium (PubChem CID 163612261) has the molecular formula C10H10ClF3N3+ and a molecular weight of 264.66 g/mol. Its IUPAC name is (3-chloro-1,1,1-trifluoro-4-imino-4-pyridin-3-ylbut-2-en-2-yl)-methylazanium.
| Compound Name | (3-chloro-1,1,1-trifluoro-4-imino-4-pyridin-3-ylbut-2-en-2-yl)-methylazanium |
|---|---|
| PubChem CID | 163612261 |
| Molecular Formula | C10H10ClF3N3+ |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (3-chloro-1,1,1-trifluoro-4-imino-4-pyridin-3-ylbut-2-en-2-yl)-methylazanium |
| SMILES | [H]/N=C(/C(Cl)=C([NH2+]C)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C10H9ClF3N3/c1-16-9(10(12,13)14)7(11)8(15)6-3-2-4-17-5-6/h2-5,15-16H,1H3/p+1/b9-7?,15-8+ |
| InChIKey | HGYNWRINCYGQFH-KAIGDTDQSA-O |
| XLogP | 1.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|