C16H27N3 — CID 176694483
(Z)-2,3-dimethyl-1-pyridin-3-ylpent-2-ene-1,4-diimine;ethane (PubChem CID 176694483) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (Z)-2,3-dimethyl-1-pyridin-3-ylpent-2-ene-1,4-diimine;ethane.
| Compound Name | (Z)-2,3-dimethyl-1-pyridin-3-ylpent-2-ene-1,4-diimine;ethane |
|---|---|
| PubChem CID | 176694483 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (Z)-2,3-dimethyl-1-pyridin-3-ylpent-2-ene-1,4-diimine;ethane |
| SMILES | CC.CC.[H]/N=C(C(/C)=C(C)\C(C)=N\[H])\c1cccnc1 |
| InChI | InChI=1S/C12H15N3.2C2H6/c1-8(10(3)13)9(2)12(14)11-5-4-6-15-7-11;2*1-2/h4-7,13-14H,1-3H3;2*1-2H3/b9-8-,13-10+,14-12-;; |
| InChIKey | ZIAJQGJKAFXHCA-DZBFDUSLSA-N |
| XLogP | 4.88 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|