C24H40N2O2 — CID 163612844
2-[3-(dimethylamino)propyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-hydroxy-3a,4,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 163612844) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-hydroxy-3a,4,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | 2-[3-(dimethylamino)propyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-hydroxy-3a,4,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 163612844 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-5-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-hydroxy-3a,4,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=CCC2C(=O)N(CCCN(C)C)C(O)C2C1 |
| InChI | InChI=1S/C24H40N2O2/c1-18(2)9-6-10-19(3)11-7-12-20-13-14-21-22(17-20)24(28)26(23(21)27)16-8-15-25(4)5/h9,11,13,21-22,24,28H,6-8,10,12,14-17H2,1-5H3/b19-11+ |
| InChIKey | HHKXSIPALXKKLM-YBFXNURJSA-N |
| XLogP | 4.52 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|