C21H35NO3 — CID 101452080
(3aS,4S,7aR)-6-hexyl-4-[(1S)-1-hydroxyhexyl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 101452080) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (3aS,4S,7aR)-6-hexyl-4-[(1S)-1-hydroxyhexyl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aR)-6-hexyl-4-[(1S)-1-hydroxyhexyl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 101452080 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (3aS,4S,7aR)-6-hexyl-4-[(1S)-1-hydroxyhexyl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCCCCC1=C[C@H]([C@@H](O)CCCCC)[C@@H]2C(=O)N(C)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C21H35NO3/c1-4-6-8-10-11-15-13-16(18(23)12-9-7-5-2)19-17(14-15)20(24)22(3)21(19)25/h13,16-19,23H,4-12,14H2,1-3H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | HSOFPPSJLFEYGF-YRXWBPOGSA-N |
| XLogP | 4.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|