C21H28N2O5 — CID 102318563
methyl (2S)-1-[(3aS,4R,7aS)-2-methyl-6-(4-methylpent-3-enyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 102318563) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl (2S)-1-[(3aS,4R,7aS)-2-methyl-6-(4-methylpent-3-enyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(3aS,4R,7aS)-2-methyl-6-(4-methylpent-3-enyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102318563 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | methyl (2S)-1-[(3aS,4R,7aS)-2-methyl-6-(4-methylpent-3-enyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(=O)N1[C@@H]1C=C(CCC=C(C)C)C[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C21H28N2O5/c1-12(2)6-5-7-13-10-14-18(20(26)22(3)19(14)25)16(11-13)23-15(21(27)28-4)8-9-17(23)24/h6,11,14-16,18H,5,7-10H2,1-4H3/t14-,15-,16+,18-/m0/s1 |
| InChIKey | GBCIGZWDUPRFEG-CUSZFKRNSA-N |
| XLogP | 1.83 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|