C15H21NO2 — CID 10753025
(3aS,8S,8aR)-2-methyl-8-propyl-4,5,6,7,8,8a-hexahydro-3aH-cyclopenta[f]isoindole-1,3-dione (PubChem CID 10753025) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3aS,8S,8aR)-2-methyl-8-propyl-4,5,6,7,8,8a-hexahydro-3aH-cyclopenta[f]isoindole-1,3-dione.
| Compound Name | (3aS,8S,8aR)-2-methyl-8-propyl-4,5,6,7,8,8a-hexahydro-3aH-cyclopenta[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10753025 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3aS,8S,8aR)-2-methyl-8-propyl-4,5,6,7,8,8a-hexahydro-3aH-cyclopenta[f]isoindole-1,3-dione |
| SMILES | CCC[C@@H]1C2=C(CCC2)C[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C15H21NO2/c1-3-5-11-10-7-4-6-9(10)8-12-13(11)15(18)16(2)14(12)17/h11-13H,3-8H2,1-2H3/t11-,12+,13-/m1/s1 |
| InChIKey | GWUQORWJHXKQHM-FRRDWIJNSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|