C20H35N3O2 — CID 70094762
4-(6-piperidin-1-ylhexanoyl)-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one (PubChem CID 70094762) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-(6-piperidin-1-ylhexanoyl)-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | 4-(6-piperidin-1-ylhexanoyl)-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 70094762 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 4-(6-piperidin-1-ylhexanoyl)-6-propyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
| SMILES | CCCC1C(=O)N(C(=O)CCCCCN2CCCCC2)C2CCNC12 |
| InChI | InChI=1S/C20H35N3O2/c1-2-9-16-19-17(11-12-21-19)23(20(16)25)18(24)10-5-3-6-13-22-14-7-4-8-15-22/h16-17,19,21H,2-15H2,1H3 |
| InChIKey | BYPONZHGRCMCED-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|