C16H35NO2 — CID 144937454
3-butyl-1,4-dimethylpyrrolidine-2,5-dione;ethane (PubChem CID 144937454) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is 3-butyl-1,4-dimethylpyrrolidine-2,5-dione;ethane.
| Compound Name | 3-butyl-1,4-dimethylpyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 144937454 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | 3-butyl-1,4-dimethylpyrrolidine-2,5-dione;ethane |
| SMILES | CC.CC.CC.CCCCC1C(=O)N(C)C(=O)C1C |
| InChI | InChI=1S/C10H17NO2.3C2H6/c1-4-5-6-8-7(2)9(12)11(3)10(8)13;3*1-2/h7-8H,4-6H2,1-3H3;3*1-2H3 |
| InChIKey | KXRSRDZXXPUMOQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|