C13H26N2O4S — CID 159666639
2,6-dibutyl-4-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dione;methane (PubChem CID 159666639) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2,6-dibutyl-4-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dione;methane.
| Compound Name | 2,6-dibutyl-4-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dione;methane |
|---|---|
| PubChem CID | 159666639 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2,6-dibutyl-4-methyl-1,1-dioxo-1,2,6-thiadiazinane-3,5-dione;methane |
| SMILES | C.CCCCN1C(=O)C(C)C(=O)N(CCCC)S1(=O)=O |
| InChI | InChI=1S/C12H22N2O4S.CH4/c1-4-6-8-13-11(15)10(3)12(16)14(9-7-5-2)19(13,17)18;/h10H,4-9H2,1-3H3;1H4 |
| InChIKey | MTMIJWAEXPYVNU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|