C45H80N2O4 — CID 170380737
3-[2-(3-ethyl-12,13-dimethylnonadecan-3-yl)-3-hydroxy-7-methyl-1-oxo-3a,4,5,7a-tetrahydro-3H-isoindol-5-yl]-1-nonylpyrrolidine-2,5-dione (PubChem CID 170380737) has the molecular formula C45H80N2O4 and a molecular weight of 713.14 g/mol. Its IUPAC name is 3-[2-(3-ethyl-12,13-dimethylnonadecan-3-yl)-3-hydroxy-7-methyl-1-oxo-3a,4,5,7a-tetrahydro-3H-isoindol-5-yl]-1-nonylpyrrolidine-2,5-dione.
| Compound Name | 3-[2-(3-ethyl-12,13-dimethylnonadecan-3-yl)-3-hydroxy-7-methyl-1-oxo-3a,4,5,7a-tetrahydro-3H-isoindol-5-yl]-1-nonylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170380737 |
| Molecular Formula | C45H80N2O4 |
| Molecular Weight | 713.14 g/mol |
| Exact Mass | 712.61 |
| IUPAC Name | 3-[2-(3-ethyl-12,13-dimethylnonadecan-3-yl)-3-hydroxy-7-methyl-1-oxo-3a,4,5,7a-tetrahydro-3H-isoindol-5-yl]-1-nonylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCN1C(=O)CC(C2C=C(C)C3C(=O)N(C(CC)(CC)CCCCCCCCC(C)C(C)CCCCCC)C(O)C3C2)C1=O |
| InChI | InChI=1S/C45H80N2O4/c1-8-12-14-16-19-22-26-30-46-40(48)33-38(42(46)49)37-31-36(7)41-39(32-37)43(50)47(44(41)51)45(10-3,11-4)29-25-21-18-17-20-24-28-35(6)34(5)27-23-15-13-9-2/h31,34-35,37-39,41,43,50H,8-30,32-33H2,1-7H3 |
| InChIKey | UKYJKYAXCSAVMN-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.14 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|