C35H60N2O4 — CID 167042078
6-(9,10-dimethyloctadecyl)-2-pentan-3-yl-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 167042078) has the molecular formula C35H60N2O4 and a molecular weight of 572.88 g/mol. Its IUPAC name is 6-(9,10-dimethyloctadecyl)-2-pentan-3-yl-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-(9,10-dimethyloctadecyl)-2-pentan-3-yl-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 167042078 |
| Molecular Formula | C35H60N2O4 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.46 |
| IUPAC Name | 6-(9,10-dimethyloctadecyl)-2-pentan-3-yl-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCCCCCCCC(C)C(C)CCCCCCCCN1C(=O)C2CC3C(=O)N(C(CC)CC)C(=O)C3CC2C1=O |
| InChI | InChI=1S/C35H60N2O4/c1-6-9-10-11-14-17-20-25(4)26(5)21-18-15-12-13-16-19-22-36-32(38)28-23-30-31(24-29(28)33(36)39)35(41)37(34(30)40)27(7-2)8-3/h25-31H,6-24H2,1-5H3 |
| InChIKey | DEMAWIGVMFQCQU-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|