About methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate
methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate (PubChem CID 163615244) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate.
Molecular Properties
| Compound Name | methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate |
| PubChem CID | 163615244 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C1=CC2C=C(C)C=CC2O1 |
| InChI | InChI=1S/C17H23NO4/c1-10(2)7-13(17(20)21-4)18-16(19)15-9-12-8-11(3)5-6-14(12)22-15/h5-6,8-10,12-14H,7H2,1-4H3,(H,18,19) |
| InChIKey | HJKFMTHDPDGSLQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate?
The IUPAC name of methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate (CID 163615244) is methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate.
What is the SMILES notation for methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate?
The canonical SMILES for methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate is COC(=O)C(CC(C)C)NC(=O)C1=CC2C=C(C)C=CC2O1.
What is the InChIKey of methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate?
The InChIKey is HJKFMTHDPDGSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-10(2)7-13(17(20)21-4)18-16(19)15-9-12-8-11(3)5-6-14(12)22-15/h5-6,8-10,12-14H,7H2,1-4H3,(H,18,19).
What are the key properties of methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate?
methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate has a molecular weight of 305.37 g/mol, XLogP of 2.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-2-[(5-methyl-3a,7a-dihydro-1-benzofuran-2-carbonyl)amino]pentanoate is sourced from PubChem (CID 163615244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).