C11H12FINO3- — CID 163619235
[(2S)-3-(2-fluorophenyl)-1-methyliodanuidyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 163619235) has the molecular formula C11H12FINO3- and a molecular weight of 352.12 g/mol. Its IUPAC name is [(2S)-3-(2-fluorophenyl)-1-methyliodanuidyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-(2-fluorophenyl)-1-methyliodanuidyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 163619235 |
| Molecular Formula | C11H12FINO3- |
| Molecular Weight | 352.12 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | [(2S)-3-(2-fluorophenyl)-1-methyliodanuidyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | C[I-]C(=O)[C@H](Cc1ccccc1F)NC(=O)O |
| InChI | InChI=1S/C11H12FINO3/c1-13-10(15)9(14-11(16)17)6-7-4-2-3-5-8(7)12/h2-5,9,14H,6H2,1H3,(H,16,17)/q-1/t9-/m0/s1 |
| InChIKey | XOIZFNZVGLZWBX-VIFPVBQESA-N |
| XLogP | -1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.12 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|