C22H35FN3O8P — CID 137379087
[6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamic acid (PubChem CID 137379087) has the molecular formula C22H35FN3O8P and a molecular weight of 519.51 g/mol. Its IUPAC name is [6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 137379087 |
| Molecular Formula | C22H35FN3O8P |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | [6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamic acid |
| SMILES | CCOP(=O)(CC(=O)NCCCCC(NC(=O)O)C(=O)NC(CO)Cc1ccccc1F)OCC |
| InChI | InChI=1S/C22H35FN3O8P/c1-3-33-35(32,34-4-2)15-20(28)24-12-8-7-11-19(26-22(30)31)21(29)25-17(14-27)13-16-9-5-6-10-18(16)23/h5-6,9-10,17,19,26-27H,3-4,7-8,11-15H2,1-2H3,(H,24,28)(H,25,29)(H,30,31) |
| InChIKey | URHZNOWQUWAKSI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|