C29H41FN3O8P — CID 122695617
benzyl N-[6-[(2-diethoxyphosphorylacetyl)amino]-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamate (PubChem CID 122695617) has the molecular formula C29H41FN3O8P and a molecular weight of 609.63 g/mol. Its IUPAC name is benzyl N-[6-[(2-diethoxyphosphorylacetyl)amino]-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[6-[(2-diethoxyphosphorylacetyl)amino]-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 122695617 |
| Molecular Formula | C29H41FN3O8P |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | benzyl N-[6-[(2-diethoxyphosphorylacetyl)amino]-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
| SMILES | CCOP(=O)(CC(=O)NCCCCC(NC(=O)OCc1ccccc1)C(=O)N[C@H](CO)Cc1ccccc1F)OCC |
| InChI | InChI=1S/C29H41FN3O8P/c1-3-40-42(38,41-4-2)21-27(35)31-17-11-10-16-26(33-29(37)39-20-22-12-6-5-7-13-22)28(36)32-24(19-34)18-23-14-8-9-15-25(23)30/h5-9,12-15,24,26,34H,3-4,10-11,16-21H2,1-2H3,(H,31,35)(H,32,36)(H,33,37)/t24-,26?/m0/s1 |
| InChIKey | GAAVLQBWMCIXRT-QSAPEBAKSA-N |
| XLogP | 3.69 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|