C23H38N3O8P — CID 137379100
[6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-hydroxy-3-(3-methylphenyl)propan-2-yl]amino]-1-oxohexan-2-yl] carbamate (PubChem CID 137379100) has the molecular formula C23H38N3O8P and a molecular weight of 515.54 g/mol. Its IUPAC name is [6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-hydroxy-3-(3-methylphenyl)propan-2-yl]amino]-1-oxohexan-2-yl] carbamate.
| Compound Name | [6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-hydroxy-3-(3-methylphenyl)propan-2-yl]amino]-1-oxohexan-2-yl] carbamate |
|---|---|
| PubChem CID | 137379100 |
| Molecular Formula | C23H38N3O8P |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | [6-[(2-diethoxyphosphorylacetyl)amino]-1-[[1-hydroxy-3-(3-methylphenyl)propan-2-yl]amino]-1-oxohexan-2-yl] carbamate |
| SMILES | CCOP(=O)(CC(=O)NCCCCC(OC(N)=O)C(=O)NC(CO)Cc1cccc(C)c1)OCC |
| InChI | InChI=1S/C23H38N3O8P/c1-4-32-35(31,33-5-2)16-21(28)25-12-7-6-11-20(34-23(24)30)22(29)26-19(15-27)14-18-10-8-9-17(3)13-18/h8-10,13,19-20,27H,4-7,11-12,14-16H2,1-3H3,(H2,24,30)(H,25,28)(H,26,29) |
| InChIKey | OGDTZCZXMCRCSA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|