C22H36N3O8P — CID 137379151
[6-[(2-diethoxyphosphorylacetyl)amino]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1-oxohexan-2-yl]carbamic acid (PubChem CID 137379151) has the molecular formula C22H36N3O8P and a molecular weight of 501.52 g/mol. Its IUPAC name is [6-[(2-diethoxyphosphorylacetyl)amino]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [6-[(2-diethoxyphosphorylacetyl)amino]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 137379151 |
| Molecular Formula | C22H36N3O8P |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | [6-[(2-diethoxyphosphorylacetyl)amino]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1-oxohexan-2-yl]carbamic acid |
| SMILES | CCOP(=O)(CC(=O)NCCCCC(NC(=O)O)C(=O)NC(CO)Cc1ccccc1)OCC |
| InChI | InChI=1S/C22H36N3O8P/c1-3-32-34(31,33-4-2)16-20(27)23-13-9-8-12-19(25-22(29)30)21(28)24-18(15-26)14-17-10-6-5-7-11-17/h5-7,10-11,18-19,25-26H,3-4,8-9,12-16H2,1-2H3,(H,23,27)(H,24,28)(H,29,30) |
| InChIKey | MRYNRRQCAQXJRO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|