C30H42FN2O8P — CID 147777379
benzyl N-[9-diethoxyphosphoryl-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1,8-dioxononan-2-yl]carbamate (PubChem CID 147777379) has the molecular formula C30H42FN2O8P and a molecular weight of 608.64 g/mol. Its IUPAC name is benzyl N-[9-diethoxyphosphoryl-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1,8-dioxononan-2-yl]carbamate.
| Compound Name | benzyl N-[9-diethoxyphosphoryl-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1,8-dioxononan-2-yl]carbamate |
|---|---|
| PubChem CID | 147777379 |
| Molecular Formula | C30H42FN2O8P |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | benzyl N-[9-diethoxyphosphoryl-1-[[(2S)-1-(2-fluorophenyl)-3-hydroxypropan-2-yl]amino]-1,8-dioxononan-2-yl]carbamate |
| SMILES | CCOP(=O)(CC(=O)CCCCCC(NC(=O)OCc1ccccc1)C(=O)N[C@H](CO)Cc1ccccc1F)OCC |
| InChI | InChI=1S/C30H42FN2O8P/c1-3-40-42(38,41-4-2)22-26(35)16-9-6-10-18-28(33-30(37)39-21-23-13-7-5-8-14-23)29(36)32-25(20-34)19-24-15-11-12-17-27(24)31/h5,7-8,11-15,17,25,28,34H,3-4,6,9-10,16,18-22H2,1-2H3,(H,32,36)(H,33,37)/t25-,28?/m0/s1 |
| InChIKey | HHCPZBPHPYIHGY-ALLRNTDFSA-N |
| XLogP | 4.93 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|