C22H28N2O3 — CID 163621098
3-benzyl-3-azabicyclo[3.2.1]octan-8-amine;(2S)-2-hydroxy-2-phenylacetic acid (PubChem CID 163621098) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-benzyl-3-azabicyclo[3.2.1]octan-8-amine;(2S)-2-hydroxy-2-phenylacetic acid.
| Compound Name | 3-benzyl-3-azabicyclo[3.2.1]octan-8-amine;(2S)-2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 163621098 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-benzyl-3-azabicyclo[3.2.1]octan-8-amine;(2S)-2-hydroxy-2-phenylacetic acid |
| SMILES | NC1C2CCC1CN(Cc1ccccc1)C2.O=C(O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2.C8H8O3/c15-14-12-6-7-13(14)10-16(9-12)8-11-4-2-1-3-5-11;9-7(8(10)11)6-4-2-1-3-5-6/h1-5,12-14H,6-10,15H2;1-5,7,9H,(H,10,11)/t;7-/m.0/s1 |
| InChIKey | HODXEBGHQGFBSY-ZLTKDMPESA-N |
| XLogP | 2.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |